C27H26F6O3S — CID 146390675
[3,3,3-trifluoro-2-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]sulfanylmethyl]propyl] prop-2-enoate (PubChem CID 146390675) has the molecular formula C27H26F6O3S and a molecular weight of 544.56 g/mol. Its IUPAC name is [3,3,3-trifluoro-2-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]sulfanylmethyl]propyl] prop-2-enoate.
| Compound Name | [3,3,3-trifluoro-2-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]sulfanylmethyl]propyl] prop-2-enoate |
|---|---|
| PubChem CID | 146390675 |
| Molecular Formula | C27H26F6O3S |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | [3,3,3-trifluoro-2-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]sulfanylmethyl]propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(CSc1ccc2cc(-c3ccc(CCCCC)cc3C(F)(F)F)oc2c1)C(F)(F)F |
| InChI | InChI=1S/C27H26F6O3S/c1-3-5-6-7-17-8-11-21(22(12-17)27(31,32)33)24-13-18-9-10-20(14-23(18)36-24)37-16-19(26(28,29)30)15-35-25(34)4-2/h4,8-14,19H,2-3,5-7,15-16H2,1H3 |
| InChIKey | HLWKKHOTFJPKLR-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|