C34H41F6NO5 — CID 146390713
[3-[[3-[1-ethyl-2-(2-ethyl-4-pentylphenyl)indol-6-yl]oxy-1,1-difluoropropoxy]-difluoromethoxy]-3,3-difluoropropyl] 2-methylprop-2-enoate (PubChem CID 146390713) has the molecular formula C34H41F6NO5 and a molecular weight of 657.69 g/mol. Its IUPAC name is [3-[[3-[1-ethyl-2-(2-ethyl-4-pentylphenyl)indol-6-yl]oxy-1,1-difluoropropoxy]-difluoromethoxy]-3,3-difluoropropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[[3-[1-ethyl-2-(2-ethyl-4-pentylphenyl)indol-6-yl]oxy-1,1-difluoropropoxy]-difluoromethoxy]-3,3-difluoropropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146390713 |
| Molecular Formula | C34H41F6NO5 |
| Molecular Weight | 657.69 g/mol |
| Exact Mass | 657.29 |
| IUPAC Name | [3-[[3-[1-ethyl-2-(2-ethyl-4-pentylphenyl)indol-6-yl]oxy-1,1-difluoropropoxy]-difluoromethoxy]-3,3-difluoropropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(F)(F)OC(F)(F)OC(F)(F)CCOc1ccc2cc(-c3ccc(CCCCC)cc3CC)n(CC)c2c1 |
| InChI | InChI=1S/C34H41F6NO5/c1-6-9-10-11-24-12-15-28(25(7-2)20-24)30-21-26-13-14-27(22-29(26)41(30)8-3)43-18-16-32(35,36)45-34(39,40)46-33(37,38)17-19-44-31(42)23(4)5/h12-15,20-22H,4,6-11,16-19H2,1-3,5H3 |
| InChIKey | WWXLHYOJLONEDF-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 58.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.69 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|