C33H39F6NO5 — CID 146390714
[3-[[1,1-difluoro-3-[2-(2-methyl-4-pentylphenyl)-1-propan-2-ylindol-6-yl]oxypropoxy]-difluoromethoxy]-3,3-difluoropropyl] prop-2-enoate (PubChem CID 146390714) has the molecular formula C33H39F6NO5 and a molecular weight of 643.67 g/mol. Its IUPAC name is [3-[[1,1-difluoro-3-[2-(2-methyl-4-pentylphenyl)-1-propan-2-ylindol-6-yl]oxypropoxy]-difluoromethoxy]-3,3-difluoropropyl] prop-2-enoate.
| Compound Name | [3-[[1,1-difluoro-3-[2-(2-methyl-4-pentylphenyl)-1-propan-2-ylindol-6-yl]oxypropoxy]-difluoromethoxy]-3,3-difluoropropyl] prop-2-enoate |
|---|---|
| PubChem CID | 146390714 |
| Molecular Formula | C33H39F6NO5 |
| Molecular Weight | 643.67 g/mol |
| Exact Mass | 643.27 |
| IUPAC Name | [3-[[1,1-difluoro-3-[2-(2-methyl-4-pentylphenyl)-1-propan-2-ylindol-6-yl]oxypropoxy]-difluoromethoxy]-3,3-difluoropropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCC(F)(F)OC(F)(F)OC(F)(F)CCOc1ccc2cc(-c3ccc(CCCCC)cc3C)n(C(C)C)c2c1 |
| InChI | InChI=1S/C33H39F6NO5/c1-6-8-9-10-24-11-14-27(23(5)19-24)29-20-25-12-13-26(21-28(25)40(29)22(3)4)42-17-15-31(34,35)44-33(38,39)45-32(36,37)16-18-43-30(41)7-2/h7,11-14,19-22H,2,6,8-10,15-18H2,1,3-5H3 |
| InChIKey | RLBXGKOGUCDFEY-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 58.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.67 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|