C27H31F2NO3S — CID 146390716
[7-[[2-(2,6-diethyl-3-pyridinyl)-1-benzofuran-6-yl]sulfanyl]-4,4-difluoroheptyl] prop-2-enoate (PubChem CID 146390716) has the molecular formula C27H31F2NO3S and a molecular weight of 487.61 g/mol. Its IUPAC name is [7-[[2-(2,6-diethyl-3-pyridinyl)-1-benzofuran-6-yl]sulfanyl]-4,4-difluoroheptyl] prop-2-enoate.
| Compound Name | [7-[[2-(2,6-diethyl-3-pyridinyl)-1-benzofuran-6-yl]sulfanyl]-4,4-difluoroheptyl] prop-2-enoate |
|---|---|
| PubChem CID | 146390716 |
| Molecular Formula | C27H31F2NO3S |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | [7-[[2-(2,6-diethyl-3-pyridinyl)-1-benzofuran-6-yl]sulfanyl]-4,4-difluoroheptyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCCC(F)(F)CCCSc1ccc2cc(-c3ccc(CC)nc3CC)oc2c1 |
| InChI | InChI=1S/C27H31F2NO3S/c1-4-20-10-12-22(23(5-2)30-20)25-17-19-9-11-21(18-24(19)33-25)34-16-8-14-27(28,29)13-7-15-32-26(31)6-3/h6,9-12,17-18H,3-5,7-8,13-16H2,1-2H3 |
| InChIKey | XBDJVMLJMAMPDA-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|