C30H29F9O5S — CID 146390744
[3-[[1,1-difluoro-3-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]sulfanyl]propoxy]-difluoromethoxy]-3,3-difluoropropyl] prop-2-enoate (PubChem CID 146390744) has the molecular formula C30H29F9O5S and a molecular weight of 672.61 g/mol. Its IUPAC name is [3-[[1,1-difluoro-3-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]sulfanyl]propoxy]-difluoromethoxy]-3,3-difluoropropyl] prop-2-enoate.
| Compound Name | [3-[[1,1-difluoro-3-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]sulfanyl]propoxy]-difluoromethoxy]-3,3-difluoropropyl] prop-2-enoate |
|---|---|
| PubChem CID | 146390744 |
| Molecular Formula | C30H29F9O5S |
| Molecular Weight | 672.61 g/mol |
| Exact Mass | 672.16 |
| IUPAC Name | [3-[[1,1-difluoro-3-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]sulfanyl]propoxy]-difluoromethoxy]-3,3-difluoropropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCC(F)(F)OC(F)(F)OC(F)(F)CCSc1ccc2cc(-c3ccc(CCCCC)cc3C(F)(F)F)oc2c1 |
| InChI | InChI=1S/C30H29F9O5S/c1-3-5-6-7-19-8-11-22(23(16-19)29(35,36)37)25-17-20-9-10-21(18-24(20)42-25)45-15-13-28(33,34)44-30(38,39)43-27(31,32)12-14-41-26(40)4-2/h4,8-11,16-18H,2-3,5-7,12-15H2,1H3 |
| InChIKey | WSFNWEUWJAVOSN-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.61 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|