C31H34F6O5S — CID 146390747
[3-[[3-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]sulfanyl]-1,1-difluoropropoxy]-difluoromethoxy]-3,3-difluoropropyl] prop-2-enoate (PubChem CID 146390747) has the molecular formula C31H34F6O5S and a molecular weight of 632.66 g/mol. Its IUPAC name is [3-[[3-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]sulfanyl]-1,1-difluoropropoxy]-difluoromethoxy]-3,3-difluoropropyl] prop-2-enoate.
| Compound Name | [3-[[3-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]sulfanyl]-1,1-difluoropropoxy]-difluoromethoxy]-3,3-difluoropropyl] prop-2-enoate |
|---|---|
| PubChem CID | 146390747 |
| Molecular Formula | C31H34F6O5S |
| Molecular Weight | 632.66 g/mol |
| Exact Mass | 632.20 |
| IUPAC Name | [3-[[3-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]sulfanyl]-1,1-difluoropropoxy]-difluoromethoxy]-3,3-difluoropropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCC(F)(F)OC(F)(F)OC(F)(F)CCSc1ccc2cc(-c3ccc(CCCCC)cc3CC)oc2c1 |
| InChI | InChI=1S/C31H34F6O5S/c1-4-7-8-9-21-10-13-25(22(5-2)18-21)27-19-23-11-12-24(20-26(23)40-27)43-17-15-30(34,35)42-31(36,37)41-29(32,33)14-16-39-28(38)6-3/h6,10-13,18-20H,3-5,7-9,14-17H2,1-2H3 |
| InChIKey | KYONHKCBRCTCTD-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.66 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|