C32H36F6O5S — CID 146390748
[3-[[3-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]sulfanyl]-1,1-difluoropropoxy]-difluoromethoxy]-3,3-difluoropropyl] 2-methylprop-2-enoate (PubChem CID 146390748) has the molecular formula C32H36F6O5S and a molecular weight of 646.69 g/mol. Its IUPAC name is [3-[[3-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]sulfanyl]-1,1-difluoropropoxy]-difluoromethoxy]-3,3-difluoropropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[[3-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]sulfanyl]-1,1-difluoropropoxy]-difluoromethoxy]-3,3-difluoropropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146390748 |
| Molecular Formula | C32H36F6O5S |
| Molecular Weight | 646.69 g/mol |
| Exact Mass | 646.22 |
| IUPAC Name | [3-[[3-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]sulfanyl]-1,1-difluoropropoxy]-difluoromethoxy]-3,3-difluoropropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(F)(F)OC(F)(F)OC(F)(F)CCSc1ccc2cc(-c3ccc(CCCCC)cc3CC)oc2c1 |
| InChI | InChI=1S/C32H36F6O5S/c1-5-7-8-9-22-10-13-26(23(6-2)18-22)28-19-24-11-12-25(20-27(24)41-28)44-17-15-31(35,36)43-32(37,38)42-30(33,34)14-16-40-29(39)21(3)4/h10-13,18-20H,3,5-9,14-17H2,1-2,4H3 |
| InChIKey | LGZFVHHUHCWSGL-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.69 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|