C30H30F8O6S — CID 146390894
[2-[[[2-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]sulfanyl]-1,1-difluoroethoxy]-difluoromethoxy]-difluoromethoxy]-2,2-difluoroethyl] prop-2-enoate (PubChem CID 146390894) has the molecular formula C30H30F8O6S and a molecular weight of 670.62 g/mol. Its IUPAC name is [2-[[[2-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]sulfanyl]-1,1-difluoroethoxy]-difluoromethoxy]-difluoromethoxy]-2,2-difluoroethyl] prop-2-enoate.
| Compound Name | [2-[[[2-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]sulfanyl]-1,1-difluoroethoxy]-difluoromethoxy]-difluoromethoxy]-2,2-difluoroethyl] prop-2-enoate |
|---|---|
| PubChem CID | 146390894 |
| Molecular Formula | C30H30F8O6S |
| Molecular Weight | 670.62 g/mol |
| Exact Mass | 670.16 |
| IUPAC Name | [2-[[[2-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]sulfanyl]-1,1-difluoroethoxy]-difluoromethoxy]-difluoromethoxy]-2,2-difluoroethyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(F)(F)OC(F)(F)OC(F)(F)OC(F)(F)CSc1ccc2cc(-c3ccc(CCCCC)cc3CC)oc2c1 |
| InChI | InChI=1S/C30H30F8O6S/c1-4-7-8-9-19-10-13-23(20(5-2)14-19)25-15-21-11-12-22(16-24(21)41-25)45-18-28(33,34)43-30(37,38)44-29(35,36)42-27(31,32)17-40-26(39)6-3/h6,10-16H,3-5,7-9,17-18H2,1-2H3 |
| InChIKey | GSLFVLRNAWVNNE-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.62 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|