C33H35F11O3S — CID 146390896
[3,3,4,4,5,5,6,6-octafluoro-8-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]sulfanyl]octyl] 2,2-dimethylpropanoate (PubChem CID 146390896) has the molecular formula C33H35F11O3S and a molecular weight of 720.69 g/mol. Its IUPAC name is [3,3,4,4,5,5,6,6-octafluoro-8-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]sulfanyl]octyl] 2,2-dimethylpropanoate.
| Compound Name | [3,3,4,4,5,5,6,6-octafluoro-8-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]sulfanyl]octyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 146390896 |
| Molecular Formula | C33H35F11O3S |
| Molecular Weight | 720.69 g/mol |
| Exact Mass | 720.21 |
| IUPAC Name | [3,3,4,4,5,5,6,6-octafluoro-8-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]sulfanyl]octyl] 2,2-dimethylpropanoate |
| SMILES | CCCCCc1ccc(-c2cc3ccc(SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOC(=O)C(C)(C)C)cc3o2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C33H35F11O3S/c1-5-6-7-8-20-9-12-23(24(17-20)31(38,39)40)26-18-21-10-11-22(19-25(21)47-26)48-16-14-30(36,37)33(43,44)32(41,42)29(34,35)13-15-46-27(45)28(2,3)4/h9-12,17-19H,5-8,13-16H2,1-4H3 |
| InChIKey | XBUOMSKNONWVGJ-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.69 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|