C33H36F9NO3 — CID 146390978
[2,2,3,3,4,4-hexafluoro-5-[1-(3-methylbutyl)-2-[4-pentyl-2-(trifluoromethyl)phenyl]indol-6-yl]oxypentyl] prop-2-enoate (PubChem CID 146390978) has the molecular formula C33H36F9NO3 and a molecular weight of 665.64 g/mol. Its IUPAC name is [2,2,3,3,4,4-hexafluoro-5-[1-(3-methylbutyl)-2-[4-pentyl-2-(trifluoromethyl)phenyl]indol-6-yl]oxypentyl] prop-2-enoate.
| Compound Name | [2,2,3,3,4,4-hexafluoro-5-[1-(3-methylbutyl)-2-[4-pentyl-2-(trifluoromethyl)phenyl]indol-6-yl]oxypentyl] prop-2-enoate |
|---|---|
| PubChem CID | 146390978 |
| Molecular Formula | C33H36F9NO3 |
| Molecular Weight | 665.64 g/mol |
| Exact Mass | 665.26 |
| IUPAC Name | [2,2,3,3,4,4-hexafluoro-5-[1-(3-methylbutyl)-2-[4-pentyl-2-(trifluoromethyl)phenyl]indol-6-yl]oxypentyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(F)(F)C(F)(F)C(F)(F)COc1ccc2cc(-c3ccc(CCCCC)cc3C(F)(F)F)n(CCC(C)C)c2c1 |
| InChI | InChI=1S/C33H36F9NO3/c1-5-7-8-9-22-10-13-25(26(16-22)32(38,39)40)28-17-23-11-12-24(18-27(23)43(28)15-14-21(3)4)45-19-30(34,35)33(41,42)31(36,37)20-46-29(44)6-2/h6,10-13,16-18,21H,2,5,7-9,14-15,19-20H2,1,3-4H3 |
| InChIKey | ODOICKOJBUPVTP-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.64 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|