C35H43F6NO3 — CID 146390981
[5-[2-(2-ethyl-4-pentylphenyl)-1-(4-methylpentyl)indol-6-yl]oxy-2,2,3,3,4,4-hexafluoropentyl] prop-2-enoate (PubChem CID 146390981) has the molecular formula C35H43F6NO3 and a molecular weight of 639.72 g/mol. Its IUPAC name is [5-[2-(2-ethyl-4-pentylphenyl)-1-(4-methylpentyl)indol-6-yl]oxy-2,2,3,3,4,4-hexafluoropentyl] prop-2-enoate.
| Compound Name | [5-[2-(2-ethyl-4-pentylphenyl)-1-(4-methylpentyl)indol-6-yl]oxy-2,2,3,3,4,4-hexafluoropentyl] prop-2-enoate |
|---|---|
| PubChem CID | 146390981 |
| Molecular Formula | C35H43F6NO3 |
| Molecular Weight | 639.72 g/mol |
| Exact Mass | 639.31 |
| IUPAC Name | [5-[2-(2-ethyl-4-pentylphenyl)-1-(4-methylpentyl)indol-6-yl]oxy-2,2,3,3,4,4-hexafluoropentyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(F)(F)C(F)(F)C(F)(F)COc1ccc2cc(-c3ccc(CCCCC)cc3CC)n(CCCC(C)C)c2c1 |
| InChI | InChI=1S/C35H43F6NO3/c1-6-9-10-13-25-14-17-29(26(7-2)19-25)31-20-27-15-16-28(21-30(27)42(31)18-11-12-24(4)5)44-22-33(36,37)35(40,41)34(38,39)23-45-32(43)8-3/h8,14-17,19-21,24H,3,6-7,9-13,18,22-23H2,1-2,4-5H3 |
| InChIKey | ILSHRSKRSMQERD-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.72 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|