C30H33F6NO4 — CID 146390983
[5-[1-ethyl-2-(2-methoxy-4-pentylphenyl)indol-6-yl]oxy-2,2,3,3,4,4-hexafluoropentyl] prop-2-enoate (PubChem CID 146390983) has the molecular formula C30H33F6NO4 and a molecular weight of 585.59 g/mol. Its IUPAC name is [5-[1-ethyl-2-(2-methoxy-4-pentylphenyl)indol-6-yl]oxy-2,2,3,3,4,4-hexafluoropentyl] prop-2-enoate.
| Compound Name | [5-[1-ethyl-2-(2-methoxy-4-pentylphenyl)indol-6-yl]oxy-2,2,3,3,4,4-hexafluoropentyl] prop-2-enoate |
|---|---|
| PubChem CID | 146390983 |
| Molecular Formula | C30H33F6NO4 |
| Molecular Weight | 585.59 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | [5-[1-ethyl-2-(2-methoxy-4-pentylphenyl)indol-6-yl]oxy-2,2,3,3,4,4-hexafluoropentyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(F)(F)C(F)(F)C(F)(F)COc1ccc2cc(-c3ccc(CCCCC)cc3OC)n(CC)c2c1 |
| InChI | InChI=1S/C30H33F6NO4/c1-5-8-9-10-20-11-14-23(26(15-20)39-4)25-16-21-12-13-22(17-24(21)37(25)7-3)40-18-28(31,32)30(35,36)29(33,34)19-41-27(38)6-2/h6,11-17H,2,5,7-10,18-19H2,1,3-4H3 |
| InChIKey | FPYNAQDKKGIGBE-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.59 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|