C29H35F3N2O3 — CID 146391103
[2-[[2-(2,6-diethyl-3-pyridinyl)-1-propan-2-ylindol-6-yl]oxymethyl]-4,4,4-trifluorobutyl] 2-methylprop-2-enoate (PubChem CID 146391103) has the molecular formula C29H35F3N2O3 and a molecular weight of 516.60 g/mol. Its IUPAC name is [2-[[2-(2,6-diethyl-3-pyridinyl)-1-propan-2-ylindol-6-yl]oxymethyl]-4,4,4-trifluorobutyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[2-(2,6-diethyl-3-pyridinyl)-1-propan-2-ylindol-6-yl]oxymethyl]-4,4,4-trifluorobutyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146391103 |
| Molecular Formula | C29H35F3N2O3 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | [2-[[2-(2,6-diethyl-3-pyridinyl)-1-propan-2-ylindol-6-yl]oxymethyl]-4,4,4-trifluorobutyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COc1ccc2cc(-c3ccc(CC)nc3CC)n(C(C)C)c2c1)CC(F)(F)F |
| InChI | InChI=1S/C29H35F3N2O3/c1-7-22-10-12-24(25(8-2)33-22)27-13-21-9-11-23(14-26(21)34(27)19(5)6)36-16-20(15-29(30,31)32)17-37-28(35)18(3)4/h9-14,19-20H,3,7-8,15-17H2,1-2,4-6H3 |
| InChIKey | PTMKBZCQYLNKCK-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|