C37H45F8NO4 — CID 146391133
[3,3,4,4,5,5,6,6-octafluoro-8-[2-(2-methoxy-4-pentylphenyl)-1-(4-methylpentyl)indol-6-yl]oxyoctyl] prop-2-enoate (PubChem CID 146391133) has the molecular formula C37H45F8NO4 and a molecular weight of 719.75 g/mol. Its IUPAC name is [3,3,4,4,5,5,6,6-octafluoro-8-[2-(2-methoxy-4-pentylphenyl)-1-(4-methylpentyl)indol-6-yl]oxyoctyl] prop-2-enoate.
| Compound Name | [3,3,4,4,5,5,6,6-octafluoro-8-[2-(2-methoxy-4-pentylphenyl)-1-(4-methylpentyl)indol-6-yl]oxyoctyl] prop-2-enoate |
|---|---|
| PubChem CID | 146391133 |
| Molecular Formula | C37H45F8NO4 |
| Molecular Weight | 719.75 g/mol |
| Exact Mass | 719.32 |
| IUPAC Name | [3,3,4,4,5,5,6,6-octafluoro-8-[2-(2-methoxy-4-pentylphenyl)-1-(4-methylpentyl)indol-6-yl]oxyoctyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOc1ccc2cc(-c3ccc(CCCCC)cc3OC)n(CCCC(C)C)c2c1 |
| InChI | InChI=1S/C37H45F8NO4/c1-6-8-9-12-26-13-16-29(32(22-26)48-5)31-23-27-14-15-28(24-30(27)46(31)19-10-11-25(3)4)49-20-17-34(38,39)36(42,43)37(44,45)35(40,41)18-21-50-33(47)7-2/h7,13-16,22-25H,2,6,8-12,17-21H2,1,3-5H3 |
| InChIKey | PXPNGJNREHKNSV-UHFFFAOYSA-N |
| XLogP | 10.92 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.75 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|