C34H36F11NO4 — CID 146391136
[3,3,4,4,5,5,6,6-octafluoro-8-[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-propan-2-ylindol-6-yl]oxyoctyl] prop-2-enoate (PubChem CID 146391136) has the molecular formula C34H36F11NO4 and a molecular weight of 731.64 g/mol. Its IUPAC name is [3,3,4,4,5,5,6,6-octafluoro-8-[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-propan-2-ylindol-6-yl]oxyoctyl] prop-2-enoate.
| Compound Name | [3,3,4,4,5,5,6,6-octafluoro-8-[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-propan-2-ylindol-6-yl]oxyoctyl] prop-2-enoate |
|---|---|
| PubChem CID | 146391136 |
| Molecular Formula | C34H36F11NO4 |
| Molecular Weight | 731.64 g/mol |
| Exact Mass | 731.25 |
| IUPAC Name | [3,3,4,4,5,5,6,6-octafluoro-8-[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-propan-2-ylindol-6-yl]oxyoctyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOc1ccc2cc(-c3ccc(CCCCC)cc3OC(F)(F)F)n(C(C)C)c2c1 |
| InChI | InChI=1S/C34H36F11NO4/c1-5-7-8-9-22-10-13-25(28(18-22)50-34(43,44)45)27-19-23-11-12-24(20-26(23)46(27)21(3)4)48-16-14-30(35,36)32(39,40)33(41,42)31(37,38)15-17-49-29(47)6-2/h6,10-13,18-21H,2,5,7-9,14-17H2,1,3-4H3 |
| InChIKey | WJCMMXAJUWYSCN-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.64 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|