C21H15F6NO3S — CID 146391353
[2,2,3,3,4,4-hexafluoro-5-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanyl]pentyl] prop-2-enoate (PubChem CID 146391353) has the molecular formula C21H15F6NO3S and a molecular weight of 475.41 g/mol. Its IUPAC name is [2,2,3,3,4,4-hexafluoro-5-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanyl]pentyl] prop-2-enoate.
| Compound Name | [2,2,3,3,4,4-hexafluoro-5-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanyl]pentyl] prop-2-enoate |
|---|---|
| PubChem CID | 146391353 |
| Molecular Formula | C21H15F6NO3S |
| Molecular Weight | 475.41 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | [2,2,3,3,4,4-hexafluoro-5-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanyl]pentyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(F)(F)C(F)(F)C(F)(F)CSc1ccc2cc(-c3cccnc3)oc2c1 |
| InChI | InChI=1S/C21H15F6NO3S/c1-2-18(29)30-11-19(22,23)21(26,27)20(24,25)12-32-15-6-5-13-8-16(31-17(13)9-15)14-4-3-7-28-10-14/h2-10H,1,11-12H2 |
| InChIKey | BIRGTOZJGJTLLP-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.41 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|