About [2,2-dimethyl-3-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanyl]propyl] 2-methylprop-2-enoate
[2,2-dimethyl-3-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanyl]propyl] 2-methylprop-2-enoate (PubChem CID 146391454) has the molecular formula C22H23NO3S
and a molecular weight of 381.50 g/mol. Its IUPAC name is [2,2-dimethyl-3-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanyl]propyl] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [2,2-dimethyl-3-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanyl]propyl] 2-methylprop-2-enoate |
| PubChem CID | 146391454 |
| Molecular Formula | C22H23NO3S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | [2,2-dimethyl-3-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanyl]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)(C)CSc1ccc2cc(-c3cccnc3)oc2c1 |
| InChI | InChI=1S/C22H23NO3S/c1-15(2)21(24)25-13-22(3,4)14-27-18-8-7-16-10-19(26-20(16)11-18)17-6-5-9-23-12-17/h5-12H,1,13-14H2,2-4H3 |
| InChIKey | SAHIAVSAEIVBNH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2,2-dimethyl-3-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanyl]propyl] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-dimethyl-3-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanyl]propyl] 2-methylprop-2-enoate?
The IUPAC name of [2,2-dimethyl-3-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanyl]propyl] 2-methylprop-2-enoate (CID 146391454) is [2,2-dimethyl-3-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanyl]propyl] 2-methylprop-2-enoate.
What is the SMILES notation for [2,2-dimethyl-3-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanyl]propyl] 2-methylprop-2-enoate?
The canonical SMILES for [2,2-dimethyl-3-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanyl]propyl] 2-methylprop-2-enoate is C=C(C)C(=O)OCC(C)(C)CSc1ccc2cc(-c3cccnc3)oc2c1.
What is the InChIKey of [2,2-dimethyl-3-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanyl]propyl] 2-methylprop-2-enoate?
The InChIKey is SAHIAVSAEIVBNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23NO3S/c1-15(2)21(24)25-13-22(3,4)14-27-18-8-7-16-10-19(26-20(16)11-18)17-6-5-9-23-12-17/h5-12H,1,13-14H2,2-4H3.
What are the key properties of [2,2-dimethyl-3-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanyl]propyl] 2-methylprop-2-enoate?
[2,2-dimethyl-3-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanyl]propyl] 2-methylprop-2-enoate has a molecular weight of 381.50 g/mol, XLogP of 5.73, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-dimethyl-3-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanyl]propyl] 2-methylprop-2-enoate is sourced from PubChem (CID 146391454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).