About 4-[(Z)-7,7-difluoro-1-iminohept-2-en-2-yl]cyclohexan-1-amine
4-[(Z)-7,7-difluoro-1-iminohept-2-en-2-yl]cyclohexan-1-amine (PubChem CID 146392371) has the molecular formula C13H22F2N2
and a molecular weight of 244.33 g/mol. Its IUPAC name is 4-[(Z)-7,7-difluoro-1-iminohept-2-en-2-yl]cyclohexan-1-amine.
Molecular Properties
| Compound Name | 4-[(Z)-7,7-difluoro-1-iminohept-2-en-2-yl]cyclohexan-1-amine |
| PubChem CID | 146392371 |
| Molecular Formula | C13H22F2N2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 4-[(Z)-7,7-difluoro-1-iminohept-2-en-2-yl]cyclohexan-1-amine |
| SMILES | [H]/N=C/C(=C\CCCC(F)F)C1CCC(N)CC1 |
| InChI | InChI=1S/C13H22F2N2/c14-13(15)4-2-1-3-11(9-16)10-5-7-12(17)8-6-10/h3,9-10,12-13,16H,1-2,4-8,17H2/b11-3+,16-9+ |
| InChIKey | LHSSKJBSGDBCPY-LROKHPKGSA-N |
| XLogP | 3.52 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(Z)-7,7-difluoro-1-iminohept-2-en-2-yl]cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-7,7-difluoro-1-iminohept-2-en-2-yl]cyclohexan-1-amine?
The IUPAC name of 4-[(Z)-7,7-difluoro-1-iminohept-2-en-2-yl]cyclohexan-1-amine (CID 146392371) is 4-[(Z)-7,7-difluoro-1-iminohept-2-en-2-yl]cyclohexan-1-amine.
What is the SMILES notation for 4-[(Z)-7,7-difluoro-1-iminohept-2-en-2-yl]cyclohexan-1-amine?
The canonical SMILES for 4-[(Z)-7,7-difluoro-1-iminohept-2-en-2-yl]cyclohexan-1-amine is [H]/N=C/C(=C\CCCC(F)F)C1CCC(N)CC1.
What is the InChIKey of 4-[(Z)-7,7-difluoro-1-iminohept-2-en-2-yl]cyclohexan-1-amine?
The InChIKey is LHSSKJBSGDBCPY-LROKHPKGSA-N. The full InChI is InChI=1S/C13H22F2N2/c14-13(15)4-2-1-3-11(9-16)10-5-7-12(17)8-6-10/h3,9-10,12-13,16H,1-2,4-8,17H2/b11-3+,16-9+.
What are the key properties of 4-[(Z)-7,7-difluoro-1-iminohept-2-en-2-yl]cyclohexan-1-amine?
4-[(Z)-7,7-difluoro-1-iminohept-2-en-2-yl]cyclohexan-1-amine has a molecular weight of 244.33 g/mol, XLogP of 3.52, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-7,7-difluoro-1-iminohept-2-en-2-yl]cyclohexan-1-amine is sourced from PubChem (CID 146392371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).