About 2-fluoro-1,5-dimethyl-2H-pyrimidine
2-fluoro-1,5-dimethyl-2H-pyrimidine (PubChem CID 146392525) has the molecular formula C6H9FN2
and a molecular weight of 128.15 g/mol. Its IUPAC name is 2-fluoro-1,5-dimethyl-2H-pyrimidine.
Molecular Properties
| Compound Name | 2-fluoro-1,5-dimethyl-2H-pyrimidine |
| PubChem CID | 146392525 |
| Molecular Formula | C6H9FN2 |
| Molecular Weight | 128.15 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | 2-fluoro-1,5-dimethyl-2H-pyrimidine |
| SMILES | CC1=CN(C)C(F)N=C1 |
| InChI | InChI=1S/C6H9FN2/c1-5-3-8-6(7)9(2)4-5/h3-4,6H,1-2H3 |
| InChIKey | ATMRBBXYKRCUPE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.15 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-1,5-dimethyl-2H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1,5-dimethyl-2H-pyrimidine?
The IUPAC name of 2-fluoro-1,5-dimethyl-2H-pyrimidine (CID 146392525) is 2-fluoro-1,5-dimethyl-2H-pyrimidine.
What is the SMILES notation for 2-fluoro-1,5-dimethyl-2H-pyrimidine?
The canonical SMILES for 2-fluoro-1,5-dimethyl-2H-pyrimidine is CC1=CN(C)C(F)N=C1.
What is the InChIKey of 2-fluoro-1,5-dimethyl-2H-pyrimidine?
The InChIKey is ATMRBBXYKRCUPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9FN2/c1-5-3-8-6(7)9(2)4-5/h3-4,6H,1-2H3.
What are the key properties of 2-fluoro-1,5-dimethyl-2H-pyrimidine?
2-fluoro-1,5-dimethyl-2H-pyrimidine has a molecular weight of 128.15 g/mol, XLogP of 1.16, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1,5-dimethyl-2H-pyrimidine is sourced from PubChem (CID 146392525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).