C8H15FN2 — CID 146392565
(2Z,4E)-4-fluoro-2-N-methylhepta-2,4-diene-2,5-diamine (PubChem CID 146392565) has the molecular formula C8H15FN2 and a molecular weight of 158.22 g/mol. Its IUPAC name is (2Z,4E)-4-fluoro-2-N-methylhepta-2,4-diene-2,5-diamine.
| Compound Name | (2Z,4E)-4-fluoro-2-N-methylhepta-2,4-diene-2,5-diamine |
|---|---|
| PubChem CID | 146392565 |
| Molecular Formula | C8H15FN2 |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | (2Z,4E)-4-fluoro-2-N-methylhepta-2,4-diene-2,5-diamine |
| SMILES | CC/C(N)=C(F)/C=C(/C)NC |
| InChI | InChI=1S/C8H15FN2/c1-4-8(10)7(9)5-6(2)11-3/h5,11H,4,10H2,1-3H3/b6-5-,8-7+ |
| InChIKey | IPUIUIYNYXRQFV-IGTJQSIKSA-N |
| XLogP | 1.66 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|