About 6-fluoro-4-methyl-3-propan-2-yl-1,2-dihydropyridazine
6-fluoro-4-methyl-3-propan-2-yl-1,2-dihydropyridazine (PubChem CID 146392568) has the molecular formula C8H13FN2
and a molecular weight of 156.20 g/mol. Its IUPAC name is 6-fluoro-4-methyl-3-propan-2-yl-1,2-dihydropyridazine.
Molecular Properties
| Compound Name | 6-fluoro-4-methyl-3-propan-2-yl-1,2-dihydropyridazine |
| PubChem CID | 146392568 |
| Molecular Formula | C8H13FN2 |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.11 |
| IUPAC Name | 6-fluoro-4-methyl-3-propan-2-yl-1,2-dihydropyridazine |
| SMILES | CC1=C(C(C)C)NNC(F)=C1 |
| InChI | InChI=1S/C8H13FN2/c1-5(2)8-6(3)4-7(9)10-11-8/h4-5,10-11H,1-3H3 |
| InChIKey | YPTQDQTVNFIPLM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-4-methyl-3-propan-2-yl-1,2-dihydropyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-4-methyl-3-propan-2-yl-1,2-dihydropyridazine?
The IUPAC name of 6-fluoro-4-methyl-3-propan-2-yl-1,2-dihydropyridazine (CID 146392568) is 6-fluoro-4-methyl-3-propan-2-yl-1,2-dihydropyridazine.
What is the SMILES notation for 6-fluoro-4-methyl-3-propan-2-yl-1,2-dihydropyridazine?
The canonical SMILES for 6-fluoro-4-methyl-3-propan-2-yl-1,2-dihydropyridazine is CC1=C(C(C)C)NNC(F)=C1.
What is the InChIKey of 6-fluoro-4-methyl-3-propan-2-yl-1,2-dihydropyridazine?
The InChIKey is YPTQDQTVNFIPLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13FN2/c1-5(2)8-6(3)4-7(9)10-11-8/h4-5,10-11H,1-3H3.
What are the key properties of 6-fluoro-4-methyl-3-propan-2-yl-1,2-dihydropyridazine?
6-fluoro-4-methyl-3-propan-2-yl-1,2-dihydropyridazine has a molecular weight of 156.20 g/mol, XLogP of 1.84, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-4-methyl-3-propan-2-yl-1,2-dihydropyridazine is sourced from PubChem (CID 146392568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).