About N-but-1-en-2-yl-N,N'-dimethylethanimidamide
N-but-1-en-2-yl-N,N'-dimethylethanimidamide (PubChem CID 146392602) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is N-but-1-en-2-yl-N,N'-dimethylethanimidamide.
Molecular Properties
| Compound Name | N-but-1-en-2-yl-N,N'-dimethylethanimidamide |
| PubChem CID | 146392602 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | N-but-1-en-2-yl-N,N'-dimethylethanimidamide |
| SMILES | C=C(CC)N(C)/C(C)=N/C |
| InChI | InChI=1S/C8H16N2/c1-6-7(2)10(5)8(3)9-4/h2,6H2,1,3-5H3/b9-8+ |
| InChIKey | OZBVRUJFPNSIMJ-CMDGGOBGSA-N |
| XLogP | 1.89 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-but-1-en-2-yl-N,N'-dimethylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-1-en-2-yl-N,N'-dimethylethanimidamide?
The IUPAC name of N-but-1-en-2-yl-N,N'-dimethylethanimidamide (CID 146392602) is N-but-1-en-2-yl-N,N'-dimethylethanimidamide.
What is the SMILES notation for N-but-1-en-2-yl-N,N'-dimethylethanimidamide?
The canonical SMILES for N-but-1-en-2-yl-N,N'-dimethylethanimidamide is C=C(CC)N(C)/C(C)=N/C.
What is the InChIKey of N-but-1-en-2-yl-N,N'-dimethylethanimidamide?
The InChIKey is OZBVRUJFPNSIMJ-CMDGGOBGSA-N. The full InChI is InChI=1S/C8H16N2/c1-6-7(2)10(5)8(3)9-4/h2,6H2,1,3-5H3/b9-8+.
What are the key properties of N-but-1-en-2-yl-N,N'-dimethylethanimidamide?
N-but-1-en-2-yl-N,N'-dimethylethanimidamide has a molecular weight of 140.23 g/mol, XLogP of 1.89, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-1-en-2-yl-N,N'-dimethylethanimidamide is sourced from PubChem (CID 146392602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).