About (E)-1-fluoro-N,N,N'-trimethyl-N'-propan-2-ylethene-1,2-diamine
(E)-1-fluoro-N,N,N'-trimethyl-N'-propan-2-ylethene-1,2-diamine (PubChem CID 146392648) has the molecular formula C8H17FN2
and a molecular weight of 160.24 g/mol. Its IUPAC name is (E)-1-fluoro-N,N,N'-trimethyl-N'-propan-2-ylethene-1,2-diamine.
Molecular Properties
| Compound Name | (E)-1-fluoro-N,N,N'-trimethyl-N'-propan-2-ylethene-1,2-diamine |
| PubChem CID | 146392648 |
| Molecular Formula | C8H17FN2 |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.14 |
| IUPAC Name | (E)-1-fluoro-N,N,N'-trimethyl-N'-propan-2-ylethene-1,2-diamine |
| SMILES | CC(C)N(C)/C=C(/F)N(C)C |
| InChI | InChI=1S/C8H17FN2/c1-7(2)11(5)6-8(9)10(3)4/h6-7H,1-5H3/b8-6- |
| InChIKey | YGCMXPMQKGJNOP-VURMDHGXSA-N |
| XLogP | 1.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-fluoro-N,N,N'-trimethyl-N'-propan-2-ylethene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-fluoro-N,N,N'-trimethyl-N'-propan-2-ylethene-1,2-diamine?
The IUPAC name of (E)-1-fluoro-N,N,N'-trimethyl-N'-propan-2-ylethene-1,2-diamine (CID 146392648) is (E)-1-fluoro-N,N,N'-trimethyl-N'-propan-2-ylethene-1,2-diamine.
What is the SMILES notation for (E)-1-fluoro-N,N,N'-trimethyl-N'-propan-2-ylethene-1,2-diamine?
The canonical SMILES for (E)-1-fluoro-N,N,N'-trimethyl-N'-propan-2-ylethene-1,2-diamine is CC(C)N(C)/C=C(/F)N(C)C.
What is the InChIKey of (E)-1-fluoro-N,N,N'-trimethyl-N'-propan-2-ylethene-1,2-diamine?
The InChIKey is YGCMXPMQKGJNOP-VURMDHGXSA-N. The full InChI is InChI=1S/C8H17FN2/c1-7(2)11(5)6-8(9)10(3)4/h6-7H,1-5H3/b8-6-.
What are the key properties of (E)-1-fluoro-N,N,N'-trimethyl-N'-propan-2-ylethene-1,2-diamine?
(E)-1-fluoro-N,N,N'-trimethyl-N'-propan-2-ylethene-1,2-diamine has a molecular weight of 160.24 g/mol, XLogP of 1.66, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-fluoro-N,N,N'-trimethyl-N'-propan-2-ylethene-1,2-diamine is sourced from PubChem (CID 146392648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).