About N-ethenyl-N'-propan-2-ylcarbamimidoyl fluoride
N-ethenyl-N'-propan-2-ylcarbamimidoyl fluoride (PubChem CID 146392697) has the molecular formula C6H11FN2
and a molecular weight of 130.17 g/mol. Its IUPAC name is N-ethenyl-N'-propan-2-ylcarbamimidoyl fluoride.
Molecular Properties
| Compound Name | N-ethenyl-N'-propan-2-ylcarbamimidoyl fluoride |
| PubChem CID | 146392697 |
| Molecular Formula | C6H11FN2 |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.09 |
| IUPAC Name | N-ethenyl-N'-propan-2-ylcarbamimidoyl fluoride |
| SMILES | C=CN/C(F)=N/C(C)C |
| InChI | InChI=1S/C6H11FN2/c1-4-8-6(7)9-5(2)3/h4-5H,1H2,2-3H3,(H,8,9) |
| InChIKey | URYKRTMIXJIGPO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-N'-propan-2-ylcarbamimidoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-N'-propan-2-ylcarbamimidoyl fluoride?
The IUPAC name of N-ethenyl-N'-propan-2-ylcarbamimidoyl fluoride (CID 146392697) is N-ethenyl-N'-propan-2-ylcarbamimidoyl fluoride.
What is the SMILES notation for N-ethenyl-N'-propan-2-ylcarbamimidoyl fluoride?
The canonical SMILES for N-ethenyl-N'-propan-2-ylcarbamimidoyl fluoride is C=CN/C(F)=N/C(C)C.
What is the InChIKey of N-ethenyl-N'-propan-2-ylcarbamimidoyl fluoride?
The InChIKey is URYKRTMIXJIGPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11FN2/c1-4-8-6(7)9-5(2)3/h4-5H,1H2,2-3H3,(H,8,9).
What are the key properties of N-ethenyl-N'-propan-2-ylcarbamimidoyl fluoride?
N-ethenyl-N'-propan-2-ylcarbamimidoyl fluoride has a molecular weight of 130.17 g/mol, XLogP of 1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-N'-propan-2-ylcarbamimidoyl fluoride is sourced from PubChem (CID 146392697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).