About 1-but-1-en-2-ylsulfanyl-N,N-dimethylethanamine
1-but-1-en-2-ylsulfanyl-N,N-dimethylethanamine (PubChem CID 146392762) has the molecular formula C8H17NS
and a molecular weight of 159.30 g/mol. Its IUPAC name is 1-but-1-en-2-ylsulfanyl-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 1-but-1-en-2-ylsulfanyl-N,N-dimethylethanamine |
| PubChem CID | 146392762 |
| Molecular Formula | C8H17NS |
| Molecular Weight | 159.30 g/mol |
| Exact Mass | 159.11 |
| IUPAC Name | 1-but-1-en-2-ylsulfanyl-N,N-dimethylethanamine |
| SMILES | C=C(CC)SC(C)N(C)C |
| InChI | InChI=1S/C8H17NS/c1-6-7(2)10-8(3)9(4)5/h8H,2,6H2,1,3-5H3 |
| InChIKey | YDMKNJYVXGRGAV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-but-1-en-2-ylsulfanyl-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-1-en-2-ylsulfanyl-N,N-dimethylethanamine?
The IUPAC name of 1-but-1-en-2-ylsulfanyl-N,N-dimethylethanamine (CID 146392762) is 1-but-1-en-2-ylsulfanyl-N,N-dimethylethanamine.
What is the SMILES notation for 1-but-1-en-2-ylsulfanyl-N,N-dimethylethanamine?
The canonical SMILES for 1-but-1-en-2-ylsulfanyl-N,N-dimethylethanamine is C=C(CC)SC(C)N(C)C.
What is the InChIKey of 1-but-1-en-2-ylsulfanyl-N,N-dimethylethanamine?
The InChIKey is YDMKNJYVXGRGAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NS/c1-6-7(2)10-8(3)9(4)5/h8H,2,6H2,1,3-5H3.
What are the key properties of 1-but-1-en-2-ylsulfanyl-N,N-dimethylethanamine?
1-but-1-en-2-ylsulfanyl-N,N-dimethylethanamine has a molecular weight of 159.30 g/mol, XLogP of 2.55, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-1-en-2-ylsulfanyl-N,N-dimethylethanamine is sourced from PubChem (CID 146392762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).