About 5-fluoro-3,4-dimethyl-2H-1,3-thiazole
5-fluoro-3,4-dimethyl-2H-1,3-thiazole (PubChem CID 146392807) has the molecular formula C5H8FNS
and a molecular weight of 133.19 g/mol. Its IUPAC name is 5-fluoro-3,4-dimethyl-2H-1,3-thiazole.
Molecular Properties
| Compound Name | 5-fluoro-3,4-dimethyl-2H-1,3-thiazole |
| PubChem CID | 146392807 |
| Molecular Formula | C5H8FNS |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.04 |
| IUPAC Name | 5-fluoro-3,4-dimethyl-2H-1,3-thiazole |
| SMILES | CC1=C(F)SCN1C |
| InChI | InChI=1S/C5H8FNS/c1-4-5(6)8-3-7(4)2/h3H2,1-2H3 |
| InChIKey | QAFMMVXWQIOKEB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-3,4-dimethyl-2H-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3,4-dimethyl-2H-1,3-thiazole?
The IUPAC name of 5-fluoro-3,4-dimethyl-2H-1,3-thiazole (CID 146392807) is 5-fluoro-3,4-dimethyl-2H-1,3-thiazole.
What is the SMILES notation for 5-fluoro-3,4-dimethyl-2H-1,3-thiazole?
The canonical SMILES for 5-fluoro-3,4-dimethyl-2H-1,3-thiazole is CC1=C(F)SCN1C.
What is the InChIKey of 5-fluoro-3,4-dimethyl-2H-1,3-thiazole?
The InChIKey is QAFMMVXWQIOKEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8FNS/c1-4-5(6)8-3-7(4)2/h3H2,1-2H3.
What are the key properties of 5-fluoro-3,4-dimethyl-2H-1,3-thiazole?
5-fluoro-3,4-dimethyl-2H-1,3-thiazole has a molecular weight of 133.19 g/mol, XLogP of 1.78, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3,4-dimethyl-2H-1,3-thiazole is sourced from PubChem (CID 146392807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).