About 4-bromo-3,5-dimethyl-2H-1,3-thiazole
4-bromo-3,5-dimethyl-2H-1,3-thiazole (PubChem CID 146392828) has the molecular formula C5H8BrNS
and a molecular weight of 194.10 g/mol. Its IUPAC name is 4-bromo-3,5-dimethyl-2H-1,3-thiazole.
Molecular Properties
| Compound Name | 4-bromo-3,5-dimethyl-2H-1,3-thiazole |
| PubChem CID | 146392828 |
| Molecular Formula | C5H8BrNS |
| Molecular Weight | 194.10 g/mol |
| Exact Mass | 192.96 |
| IUPAC Name | 4-bromo-3,5-dimethyl-2H-1,3-thiazole |
| SMILES | CC1=C(Br)N(C)CS1 |
| InChI | InChI=1S/C5H8BrNS/c1-4-5(6)7(2)3-8-4/h3H2,1-2H3 |
| InChIKey | DXANJYQAHXLCCV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.10 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-3,5-dimethyl-2H-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3,5-dimethyl-2H-1,3-thiazole?
The IUPAC name of 4-bromo-3,5-dimethyl-2H-1,3-thiazole (CID 146392828) is 4-bromo-3,5-dimethyl-2H-1,3-thiazole.
What is the SMILES notation for 4-bromo-3,5-dimethyl-2H-1,3-thiazole?
The canonical SMILES for 4-bromo-3,5-dimethyl-2H-1,3-thiazole is CC1=C(Br)N(C)CS1.
What is the InChIKey of 4-bromo-3,5-dimethyl-2H-1,3-thiazole?
The InChIKey is DXANJYQAHXLCCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8BrNS/c1-4-5(6)7(2)3-8-4/h3H2,1-2H3.
What are the key properties of 4-bromo-3,5-dimethyl-2H-1,3-thiazole?
4-bromo-3,5-dimethyl-2H-1,3-thiazole has a molecular weight of 194.10 g/mol, XLogP of 2.21, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3,5-dimethyl-2H-1,3-thiazole is sourced from PubChem (CID 146392828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).