About 3-chloro-6-ethyl-1,2-dihydropyridazine
3-chloro-6-ethyl-1,2-dihydropyridazine (PubChem CID 146392842) has the molecular formula C6H9ClN2
and a molecular weight of 144.60 g/mol. Its IUPAC name is 3-chloro-6-ethyl-1,2-dihydropyridazine.
Molecular Properties
| Compound Name | 3-chloro-6-ethyl-1,2-dihydropyridazine |
| PubChem CID | 146392842 |
| Molecular Formula | C6H9ClN2 |
| Molecular Weight | 144.60 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | 3-chloro-6-ethyl-1,2-dihydropyridazine |
| SMILES | CCC1=CC=C(Cl)NN1 |
| InChI | InChI=1S/C6H9ClN2/c1-2-5-3-4-6(7)9-8-5/h3-4,8-9H,2H2,1H3 |
| InChIKey | LVBRLESJFFXOIR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.60 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-6-ethyl-1,2-dihydropyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-6-ethyl-1,2-dihydropyridazine?
The IUPAC name of 3-chloro-6-ethyl-1,2-dihydropyridazine (CID 146392842) is 3-chloro-6-ethyl-1,2-dihydropyridazine.
What is the SMILES notation for 3-chloro-6-ethyl-1,2-dihydropyridazine?
The canonical SMILES for 3-chloro-6-ethyl-1,2-dihydropyridazine is CCC1=CC=C(Cl)NN1.
What is the InChIKey of 3-chloro-6-ethyl-1,2-dihydropyridazine?
The InChIKey is LVBRLESJFFXOIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClN2/c1-2-5-3-4-6(7)9-8-5/h3-4,8-9H,2H2,1H3.
What are the key properties of 3-chloro-6-ethyl-1,2-dihydropyridazine?
3-chloro-6-ethyl-1,2-dihydropyridazine has a molecular weight of 144.60 g/mol, XLogP of 1.47, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-6-ethyl-1,2-dihydropyridazine is sourced from PubChem (CID 146392842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).