C10H16F3N — CID 146392963
(2Z)-N,N,3-trimethyl-4-(trifluoromethyl)hexa-2,4-dien-2-amine (PubChem CID 146392963) has the molecular formula C10H16F3N and a molecular weight of 207.24 g/mol. Its IUPAC name is (2Z)-N,N,3-trimethyl-4-(trifluoromethyl)hexa-2,4-dien-2-amine.
| Compound Name | (2Z)-N,N,3-trimethyl-4-(trifluoromethyl)hexa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 146392963 |
| Molecular Formula | C10H16F3N |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | (2Z)-N,N,3-trimethyl-4-(trifluoromethyl)hexa-2,4-dien-2-amine |
| SMILES | CC=C(/C(C)=C(/C)N(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H16F3N/c1-6-9(10(11,12)13)7(2)8(3)14(4)5/h6H,1-5H3/b8-7-,9-6? |
| InChIKey | VSSUOAJJWVMINL-JUAXCNNKSA-N |
| XLogP | 3.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|