About 1,2,4-trimethyl-5-(trifluoromethyl)-2,3-dihydropyrrole
1,2,4-trimethyl-5-(trifluoromethyl)-2,3-dihydropyrrole (PubChem CID 146392966) has the molecular formula C8H12F3N
and a molecular weight of 179.18 g/mol. Its IUPAC name is 1,2,4-trimethyl-5-(trifluoromethyl)-2,3-dihydropyrrole.
Analyze 1,2,4-trimethyl-5-(trifluoromethyl)-2,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4-trimethyl-5-(trifluoromethyl)-2,3-dihydropyrrole?
The IUPAC name of 1,2,4-trimethyl-5-(trifluoromethyl)-2,3-dihydropyrrole (CID 146392966) is 1,2,4-trimethyl-5-(trifluoromethyl)-2,3-dihydropyrrole.
What is the SMILES notation for 1,2,4-trimethyl-5-(trifluoromethyl)-2,3-dihydropyrrole?
The canonical SMILES for 1,2,4-trimethyl-5-(trifluoromethyl)-2,3-dihydropyrrole is CC1=C(C(F)(F)F)N(C)C(C)C1.
What is the InChIKey of 1,2,4-trimethyl-5-(trifluoromethyl)-2,3-dihydropyrrole?
The InChIKey is VTHXPENKUPIPNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F3N/c1-5-4-6(2)12(3)7(5)8(9,10)11/h6H,4H2,1-3H3.
What are the key properties of 1,2,4-trimethyl-5-(trifluoromethyl)-2,3-dihydropyrrole?
1,2,4-trimethyl-5-(trifluoromethyl)-2,3-dihydropyrrole has a molecular weight of 179.18 g/mol, XLogP of 2.55, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4-trimethyl-5-(trifluoromethyl)-2,3-dihydropyrrole is sourced from PubChem (CID 146392966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).