About (4Z)-2-methoxy-4-propan-2-yl-5-(trifluoromethyl)octa-1,4-diene
(4Z)-2-methoxy-4-propan-2-yl-5-(trifluoromethyl)octa-1,4-diene (PubChem CID 146393009) has the molecular formula C13H21F3O
and a molecular weight of 250.30 g/mol. Its IUPAC name is (4Z)-2-methoxy-4-propan-2-yl-5-(trifluoromethyl)octa-1,4-diene.
Molecular Properties
| Compound Name | (4Z)-2-methoxy-4-propan-2-yl-5-(trifluoromethyl)octa-1,4-diene |
| PubChem CID | 146393009 |
| Molecular Formula | C13H21F3O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | (4Z)-2-methoxy-4-propan-2-yl-5-(trifluoromethyl)octa-1,4-diene |
| SMILES | C=C(C/C(=C(\CCC)C(F)(F)F)C(C)C)OC |
| InChI | InChI=1S/C13H21F3O/c1-6-7-12(13(14,15)16)11(9(2)3)8-10(4)17-5/h9H,4,6-8H2,1-3,5H3/b12-11- |
| InChIKey | KFBSDEBXUPFQEH-QXMHVHEDSA-N |
| XLogP | 4.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-2-methoxy-4-propan-2-yl-5-(trifluoromethyl)octa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-2-methoxy-4-propan-2-yl-5-(trifluoromethyl)octa-1,4-diene?
The IUPAC name of (4Z)-2-methoxy-4-propan-2-yl-5-(trifluoromethyl)octa-1,4-diene (CID 146393009) is (4Z)-2-methoxy-4-propan-2-yl-5-(trifluoromethyl)octa-1,4-diene.
What is the SMILES notation for (4Z)-2-methoxy-4-propan-2-yl-5-(trifluoromethyl)octa-1,4-diene?
The canonical SMILES for (4Z)-2-methoxy-4-propan-2-yl-5-(trifluoromethyl)octa-1,4-diene is C=C(C/C(=C(\CCC)C(F)(F)F)C(C)C)OC.
What is the InChIKey of (4Z)-2-methoxy-4-propan-2-yl-5-(trifluoromethyl)octa-1,4-diene?
The InChIKey is KFBSDEBXUPFQEH-QXMHVHEDSA-N. The full InChI is InChI=1S/C13H21F3O/c1-6-7-12(13(14,15)16)11(9(2)3)8-10(4)17-5/h9H,4,6-8H2,1-3,5H3/b12-11-.
What are the key properties of (4Z)-2-methoxy-4-propan-2-yl-5-(trifluoromethyl)octa-1,4-diene?
(4Z)-2-methoxy-4-propan-2-yl-5-(trifluoromethyl)octa-1,4-diene has a molecular weight of 250.30 g/mol, XLogP of 4.85, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-2-methoxy-4-propan-2-yl-5-(trifluoromethyl)octa-1,4-diene is sourced from PubChem (CID 146393009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).