About 4-bromo-N,N-dimethylpent-4-en-2-amine
4-bromo-N,N-dimethylpent-4-en-2-amine (PubChem CID 146393047) has the molecular formula C7H14BrN
and a molecular weight of 192.10 g/mol. Its IUPAC name is 4-bromo-N,N-dimethylpent-4-en-2-amine.
Molecular Properties
| Compound Name | 4-bromo-N,N-dimethylpent-4-en-2-amine |
| PubChem CID | 146393047 |
| Molecular Formula | C7H14BrN |
| Molecular Weight | 192.10 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 4-bromo-N,N-dimethylpent-4-en-2-amine |
| SMILES | C=C(Br)CC(C)N(C)C |
| InChI | InChI=1S/C7H14BrN/c1-6(8)5-7(2)9(3)4/h7H,1,5H2,2-4H3 |
| InChIKey | HQKSXMXLNLHJKP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.10 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-N,N-dimethylpent-4-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N,N-dimethylpent-4-en-2-amine?
The IUPAC name of 4-bromo-N,N-dimethylpent-4-en-2-amine (CID 146393047) is 4-bromo-N,N-dimethylpent-4-en-2-amine.
What is the SMILES notation for 4-bromo-N,N-dimethylpent-4-en-2-amine?
The canonical SMILES for 4-bromo-N,N-dimethylpent-4-en-2-amine is C=C(Br)CC(C)N(C)C.
What is the InChIKey of 4-bromo-N,N-dimethylpent-4-en-2-amine?
The InChIKey is HQKSXMXLNLHJKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14BrN/c1-6(8)5-7(2)9(3)4/h7H,1,5H2,2-4H3.
What are the key properties of 4-bromo-N,N-dimethylpent-4-en-2-amine?
4-bromo-N,N-dimethylpent-4-en-2-amine has a molecular weight of 192.10 g/mol, XLogP of 2.24, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N,N-dimethylpent-4-en-2-amine is sourced from PubChem (CID 146393047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).