About 2,4-dimethyl-3-propan-2-yl-1,3-dihydropyrazole
2,4-dimethyl-3-propan-2-yl-1,3-dihydropyrazole (PubChem CID 146393146) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is 2,4-dimethyl-3-propan-2-yl-1,3-dihydropyrazole.
Molecular Properties
| Compound Name | 2,4-dimethyl-3-propan-2-yl-1,3-dihydropyrazole |
| PubChem CID | 146393146 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 2,4-dimethyl-3-propan-2-yl-1,3-dihydropyrazole |
| SMILES | CC1=CNN(C)C1C(C)C |
| InChI | InChI=1S/C8H16N2/c1-6(2)8-7(3)5-9-10(8)4/h5-6,8-9H,1-4H3 |
| InChIKey | BDSBZIGPQYJJEQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dimethyl-3-propan-2-yl-1,3-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-3-propan-2-yl-1,3-dihydropyrazole?
The IUPAC name of 2,4-dimethyl-3-propan-2-yl-1,3-dihydropyrazole (CID 146393146) is 2,4-dimethyl-3-propan-2-yl-1,3-dihydropyrazole.
What is the SMILES notation for 2,4-dimethyl-3-propan-2-yl-1,3-dihydropyrazole?
The canonical SMILES for 2,4-dimethyl-3-propan-2-yl-1,3-dihydropyrazole is CC1=CNN(C)C1C(C)C.
What is the InChIKey of 2,4-dimethyl-3-propan-2-yl-1,3-dihydropyrazole?
The InChIKey is BDSBZIGPQYJJEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2/c1-6(2)8-7(3)5-9-10(8)4/h5-6,8-9H,1-4H3.
What are the key properties of 2,4-dimethyl-3-propan-2-yl-1,3-dihydropyrazole?
2,4-dimethyl-3-propan-2-yl-1,3-dihydropyrazole has a molecular weight of 140.23 g/mol, XLogP of 1.36, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-3-propan-2-yl-1,3-dihydropyrazole is sourced from PubChem (CID 146393146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).