C47H31F6N9 — CID 146393907
9-[4-[3,5-bis(trifluoromethyl)phenyl]-5-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-pyridinyl]-3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazole (PubChem CID 146393907) has the molecular formula C47H31F6N9 and a molecular weight of 835.82 g/mol. Its IUPAC name is 9-[4-[3,5-bis(trifluoromethyl)phenyl]-5-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-pyridinyl]-3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazole.
| Compound Name | 9-[4-[3,5-bis(trifluoromethyl)phenyl]-5-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-pyridinyl]-3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazole |
|---|---|
| PubChem CID | 146393907 |
| Molecular Formula | C47H31F6N9 |
| Molecular Weight | 835.82 g/mol |
| Exact Mass | 835.26 |
| IUPAC Name | 9-[4-[3,5-bis(trifluoromethyl)phenyl]-5-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-pyridinyl]-3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazole |
| SMILES | Cc1nc(C)nc(-c2ccc3c(c2)c2ccccc2n3-c2cc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c(-n3c4ccccc4c4cc(-c5nc(C)nc(C)n5)ccc43)cn2)n1 |
| InChI | InChI=1S/C47H31F6N9/c1-24-55-25(2)58-44(57-24)28-13-15-40-36(19-28)33-9-5-7-11-38(33)61(40)42-23-54-43(22-35(42)30-17-31(46(48,49)50)21-32(18-30)47(51,52)53)62-39-12-8-6-10-34(39)37-20-29(14-16-41(37)62)45-59-26(3)56-27(4)60-45/h5-23H,1-4H3 |
| InChIKey | SQIOKZSVNQYWCU-UHFFFAOYSA-N |
| XLogP | 11.92 |
| TPSA | 100.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.82 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |