C16H15N5 — CID 14639449
N-ethyl-1-phenyl-[1,2,4]triazolo[1,5-b]indazol-2-amine (PubChem CID 14639449) has the molecular formula C16H15N5 and a molecular weight of 277.33 g/mol. Its IUPAC name is N-ethyl-1-phenyl-[1,2,4]triazolo[1,5-b]indazol-2-amine.
| Compound Name | N-ethyl-1-phenyl-[1,2,4]triazolo[1,5-b]indazol-2-amine |
|---|---|
| PubChem CID | 14639449 |
| Molecular Formula | C16H15N5 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | N-ethyl-1-phenyl-[1,2,4]triazolo[1,5-b]indazol-2-amine |
| SMILES | CCNc1nn2nc3ccccc3c2n1-c1ccccc1 |
| InChI | InChI=1S/C16H15N5/c1-2-17-16-19-21-15(13-10-6-7-11-14(13)18-21)20(16)12-8-4-3-5-9-12/h3-11H,2H2,1H3,(H,17,19) |
| InChIKey | NNUAQERFPHWXJC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 47.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |