C12H22N2O — CID 146394692
(9aR)-2-butan-2-yl-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-6-one (PubChem CID 146394692) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is (9aR)-2-butan-2-yl-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-6-one.
| Compound Name | (9aR)-2-butan-2-yl-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-6-one |
|---|---|
| PubChem CID | 146394692 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | (9aR)-2-butan-2-yl-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-6-one |
| SMILES | CCC(C)N1CCN2C(=O)CCC[C@@H]2C1 |
| InChI | InChI=1S/C12H22N2O/c1-3-10(2)13-7-8-14-11(9-13)5-4-6-12(14)15/h10-11H,3-9H2,1-2H3/t10?,11-/m1/s1 |
| InChIKey | NFHCPXASPLKOOQ-RRKGBCIJSA-N |
| XLogP | 1.48 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |