C20H31N5O — CID 146395195
N-[2-[(dimethylamino)methyl]-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-6-yl]-7-methyl-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 146395195) has the molecular formula C20H31N5O and a molecular weight of 357.50 g/mol. Its IUPAC name is N-[2-[(dimethylamino)methyl]-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-6-yl]-7-methyl-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | N-[2-[(dimethylamino)methyl]-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-6-yl]-7-methyl-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 146395195 |
| Molecular Formula | C20H31N5O |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | N-[2-[(dimethylamino)methyl]-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-6-yl]-7-methyl-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | Cc1cccc2c1NC(C(=O)NC1CCC3NC(CN(C)C)CN3C1)C2 |
| InChI | InChI=1S/C20H31N5O/c1-13-5-4-6-14-9-17(23-19(13)14)20(26)22-15-7-8-18-21-16(10-24(2)3)12-25(18)11-15/h4-6,15-18,21,23H,7-12H2,1-3H3,(H,22,26) |
| InChIKey | HDHLXFIEDORDJL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |