C19H24O4 — CID 14639521
diethyl 3-prop-1-en-2-yl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate (PubChem CID 14639521) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is diethyl 3-prop-1-en-2-yl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate.
| Compound Name | diethyl 3-prop-1-en-2-yl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 14639521 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | diethyl 3-prop-1-en-2-yl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate |
| SMILES | C=C(C)C1Cc2ccccc2CC1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C19H24O4/c1-5-22-17(20)19(18(21)23-6-2)12-15-10-8-7-9-14(15)11-16(19)13(3)4/h7-10,16H,3,5-6,11-12H2,1-2,4H3 |
| InChIKey | GTTJSLJZOAIZDE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|