C22H30N4O2 — CID 146395359
2-amino-N-[(1R,2R,9S,17S)-6-oxo-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-5-yl]benzamide (PubChem CID 146395359) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 2-amino-N-[(1R,2R,9S,17S)-6-oxo-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-5-yl]benzamide.
| Compound Name | 2-amino-N-[(1R,2R,9S,17S)-6-oxo-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-5-yl]benzamide |
|---|---|
| PubChem CID | 146395359 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 2-amino-N-[(1R,2R,9S,17S)-6-oxo-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-5-yl]benzamide |
| SMILES | Nc1ccccc1C(=O)NC1CC[C@@H]2[C@H]3CCCN4CCC[C@@H](CN2C1=O)[C@@H]34 |
| InChI | InChI=1S/C22H30N4O2/c23-17-8-2-1-6-15(17)21(27)24-18-9-10-19-16-7-4-12-25-11-3-5-14(20(16)25)13-26(19)22(18)28/h1-2,6,8,14,16,18-20H,3-5,7,9-13,23H2,(H,24,27)/t14-,16+,18?,19+,20-/m0/s1 |
| InChIKey | LXXRLUBQAOECPT-ZYITYVDZSA-N |
| XLogP | 1.86 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|