C45H34N4O — CID 146395864
9-[7-(4-cyclohexa-1,3-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)dibenzofuran-1-yl]-3-phenyl-1,2,4b,8a-tetrahydrocarbazole (PubChem CID 146395864) has the molecular formula C45H34N4O and a molecular weight of 646.79 g/mol. Its IUPAC name is 9-[7-(4-cyclohexa-1,3-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)dibenzofuran-1-yl]-3-phenyl-1,2,4b,8a-tetrahydrocarbazole.
| Compound Name | 9-[7-(4-cyclohexa-1,3-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)dibenzofuran-1-yl]-3-phenyl-1,2,4b,8a-tetrahydrocarbazole |
|---|---|
| PubChem CID | 146395864 |
| Molecular Formula | C45H34N4O |
| Molecular Weight | 646.79 g/mol |
| Exact Mass | 646.27 |
| IUPAC Name | 9-[7-(4-cyclohexa-1,3-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)dibenzofuran-1-yl]-3-phenyl-1,2,4b,8a-tetrahydrocarbazole |
| SMILES | C1=CCCC(c2nc(-c3ccccc3)nc(-c3ccc4c(c3)oc3cccc(N5C6=C(C=C(c7ccccc7)CC6)C6C=CC=CC65)c34)n2)=C1 |
| InChI | InChI=1S/C45H34N4O/c1-4-13-29(14-5-1)32-24-26-38-36(27-32)34-19-10-11-20-37(34)49(38)39-21-12-22-40-42(39)35-25-23-33(28-41(35)50-40)45-47-43(30-15-6-2-7-16-30)46-44(48-45)31-17-8-3-9-18-31/h1-8,10-17,19-23,25,27-28,34,37H,9,18,24,26H2 |
| InChIKey | JKMAJKCQEPXGLJ-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.79 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |