C22H37N3O2 — CID 146396034
3-tert-butyl-5-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-3,3,6,6-tetramethylheptyl]-1,2,4-oxadiazole (PubChem CID 146396034) has the molecular formula C22H37N3O2 and a molecular weight of 375.56 g/mol. Its IUPAC name is 3-tert-butyl-5-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-3,3,6,6-tetramethylheptyl]-1,2,4-oxadiazole.
| Compound Name | 3-tert-butyl-5-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-3,3,6,6-tetramethylheptyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 146396034 |
| Molecular Formula | C22H37N3O2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.29 |
| IUPAC Name | 3-tert-butyl-5-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-3,3,6,6-tetramethylheptyl]-1,2,4-oxadiazole |
| SMILES | Cc1noc(C)c1CC(C)(C)CCC(C)(C)CCc1nc(C(C)(C)C)no1 |
| InChI | InChI=1S/C22H37N3O2/c1-15-17(16(2)26-24-15)14-22(8,9)13-12-21(6,7)11-10-18-23-19(25-27-18)20(3,4)5/h10-14H2,1-9H3 |
| InChIKey | ZISYOJSHQGKTGN-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |