C22H34N2 — CID 146396091
N'-[(3E,5Z)-3,7-dimethylocta-1,3,5-trien-2-yl]-N'-methyl-N-[3-(6-methylcyclohexa-1,5-dien-1-yl)prop-1-en-2-yl]methanediamine (PubChem CID 146396091) has the molecular formula C22H34N2 and a molecular weight of 326.53 g/mol. Its IUPAC name is N'-[(3E,5Z)-3,7-dimethylocta-1,3,5-trien-2-yl]-N'-methyl-N-[3-(6-methylcyclohexa-1,5-dien-1-yl)prop-1-en-2-yl]methanediamine.
| Compound Name | N'-[(3E,5Z)-3,7-dimethylocta-1,3,5-trien-2-yl]-N'-methyl-N-[3-(6-methylcyclohexa-1,5-dien-1-yl)prop-1-en-2-yl]methanediamine |
|---|---|
| PubChem CID | 146396091 |
| Molecular Formula | C22H34N2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | N'-[(3E,5Z)-3,7-dimethylocta-1,3,5-trien-2-yl]-N'-methyl-N-[3-(6-methylcyclohexa-1,5-dien-1-yl)prop-1-en-2-yl]methanediamine |
| SMILES | C=C(CC1=CCCC=C1C)NCN(C)C(=C)/C(C)=C/C=C\C(C)C |
| InChI | InChI=1S/C22H34N2/c1-17(2)11-10-13-18(3)21(6)24(7)16-23-20(5)15-22-14-9-8-12-19(22)4/h10-14,17,23H,5-6,8-9,15-16H2,1-4,7H3/b11-10-,18-13+ |
| InChIKey | LTXDPHYZIKTPDZ-UMYNCADFSA-N |
| XLogP | 5.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|