C19H17F3N6O2 — CID 146396217
(7R)-7-methyl-15-(trifluoromethyl)-11-oxa-3,4,6,13,19,24-hexazatetracyclo[18.3.1.02,6.012,17]tetracosa-1(24),2,4,12(17),13,15,20,22-octaen-18-one (PubChem CID 146396217) has the molecular formula C19H17F3N6O2 and a molecular weight of 418.38 g/mol. Its IUPAC name is (7R)-7-methyl-15-(trifluoromethyl)-11-oxa-3,4,6,13,19,24-hexazatetracyclo[18.3.1.02,6.012,17]tetracosa-1(24),2,4,12(17),13,15,20,22-octaen-18-one.
| Compound Name | (7R)-7-methyl-15-(trifluoromethyl)-11-oxa-3,4,6,13,19,24-hexazatetracyclo[18.3.1.02,6.012,17]tetracosa-1(24),2,4,12(17),13,15,20,22-octaen-18-one |
|---|---|
| PubChem CID | 146396217 |
| Molecular Formula | C19H17F3N6O2 |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (7R)-7-methyl-15-(trifluoromethyl)-11-oxa-3,4,6,13,19,24-hexazatetracyclo[18.3.1.02,6.012,17]tetracosa-1(24),2,4,12(17),13,15,20,22-octaen-18-one |
| SMILES | C[C@@H]1CCCOc2ncc(C(F)(F)F)cc2C(=O)Nc2cccc(n2)-c2nncn21 |
| InChI | InChI=1S/C19H17F3N6O2/c1-11-4-3-7-30-18-13(8-12(9-23-18)19(20,21)22)17(29)26-15-6-2-5-14(25-15)16-27-24-10-28(11)16/h2,5-6,8-11H,3-4,7H2,1H3,(H,25,26,29)/t11-/m1/s1 |
| InChIKey | DTKYZWAVVKLSDH-LLVKDONJSA-N |
| XLogP | 3.74 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |