About 1-methyl-2-[(4Z)-2-methylhexa-2,4-dien-3-yl]hydrazine
1-methyl-2-[(4Z)-2-methylhexa-2,4-dien-3-yl]hydrazine (PubChem CID 146396350) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is 1-methyl-2-[(4Z)-2-methylhexa-2,4-dien-3-yl]hydrazine.
Molecular Properties
| Compound Name | 1-methyl-2-[(4Z)-2-methylhexa-2,4-dien-3-yl]hydrazine |
| PubChem CID | 146396350 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 1-methyl-2-[(4Z)-2-methylhexa-2,4-dien-3-yl]hydrazine |
| SMILES | C/C=C\C(NNC)=C(C)C |
| InChI | InChI=1S/C8H16N2/c1-5-6-8(7(2)3)10-9-4/h5-6,9-10H,1-4H3/b6-5- |
| InChIKey | YOWUYTKKPUVVQR-WAYWQWQTSA-N |
| XLogP | 1.58 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-[(4Z)-2-methylhexa-2,4-dien-3-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-[(4Z)-2-methylhexa-2,4-dien-3-yl]hydrazine?
The IUPAC name of 1-methyl-2-[(4Z)-2-methylhexa-2,4-dien-3-yl]hydrazine (CID 146396350) is 1-methyl-2-[(4Z)-2-methylhexa-2,4-dien-3-yl]hydrazine.
What is the SMILES notation for 1-methyl-2-[(4Z)-2-methylhexa-2,4-dien-3-yl]hydrazine?
The canonical SMILES for 1-methyl-2-[(4Z)-2-methylhexa-2,4-dien-3-yl]hydrazine is C/C=C\C(NNC)=C(C)C.
What is the InChIKey of 1-methyl-2-[(4Z)-2-methylhexa-2,4-dien-3-yl]hydrazine?
The InChIKey is YOWUYTKKPUVVQR-WAYWQWQTSA-N. The full InChI is InChI=1S/C8H16N2/c1-5-6-8(7(2)3)10-9-4/h5-6,9-10H,1-4H3/b6-5-.
What are the key properties of 1-methyl-2-[(4Z)-2-methylhexa-2,4-dien-3-yl]hydrazine?
1-methyl-2-[(4Z)-2-methylhexa-2,4-dien-3-yl]hydrazine has a molecular weight of 140.23 g/mol, XLogP of 1.58, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-[(4Z)-2-methylhexa-2,4-dien-3-yl]hydrazine is sourced from PubChem (CID 146396350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).