About 13,15-diazatricyclo[6.4.2.12,7]pentadecane
13,15-diazatricyclo[6.4.2.12,7]pentadecane (PubChem CID 146396496) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is 13,15-diazatricyclo[6.4.2.12,7]pentadecane.
Molecular Properties
| Compound Name | 13,15-diazatricyclo[6.4.2.12,7]pentadecane |
| PubChem CID | 146396496 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 13,15-diazatricyclo[6.4.2.12,7]pentadecane |
| SMILES | C1CCC2NCC(C1)C1CCCCC2N1 |
| InChI | InChI=1S/C13H24N2/c1-2-7-12-13-8-4-3-6-11(15-13)10(5-1)9-14-12/h10-15H,1-9H2 |
| InChIKey | RRSLVJQEVZDZLA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 13,15-diazatricyclo[6.4.2.12,7]pentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 13,15-diazatricyclo[6.4.2.12,7]pentadecane?
The IUPAC name of 13,15-diazatricyclo[6.4.2.12,7]pentadecane (CID 146396496) is 13,15-diazatricyclo[6.4.2.12,7]pentadecane.
What is the SMILES notation for 13,15-diazatricyclo[6.4.2.12,7]pentadecane?
The canonical SMILES for 13,15-diazatricyclo[6.4.2.12,7]pentadecane is C1CCC2NCC(C1)C1CCCCC2N1.
What is the InChIKey of 13,15-diazatricyclo[6.4.2.12,7]pentadecane?
The InChIKey is RRSLVJQEVZDZLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2/c1-2-7-12-13-8-4-3-6-11(15-13)10(5-1)9-14-12/h10-15H,1-9H2.
What are the key properties of 13,15-diazatricyclo[6.4.2.12,7]pentadecane?
13,15-diazatricyclo[6.4.2.12,7]pentadecane has a molecular weight of 208.35 g/mol, XLogP of 2.05, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 13,15-diazatricyclo[6.4.2.12,7]pentadecane is sourced from PubChem (CID 146396496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).