C10H14O4 — CID 146396745
(1S,3R,7R,9R,10S,11S)-10,11-dimethyl-2,4,8-trioxatricyclo[5.3.1.03,9]undecan-5-one (PubChem CID 146396745) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (1S,3R,7R,9R,10S,11S)-10,11-dimethyl-2,4,8-trioxatricyclo[5.3.1.03,9]undecan-5-one.
| Compound Name | (1S,3R,7R,9R,10S,11S)-10,11-dimethyl-2,4,8-trioxatricyclo[5.3.1.03,9]undecan-5-one |
|---|---|
| PubChem CID | 146396745 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (1S,3R,7R,9R,10S,11S)-10,11-dimethyl-2,4,8-trioxatricyclo[5.3.1.03,9]undecan-5-one |
| SMILES | C[C@@H]1[C@@H]2O[C@@H]3OC(=O)C[C@H]1O[C@@H]3[C@H]2C |
| InChI | InChI=1S/C10H14O4/c1-4-6-3-7(11)13-10-9(12-6)5(2)8(4)14-10/h4-6,8-10H,3H2,1-2H3/t4-,5-,6+,8-,9+,10-/m0/s1 |
| InChIKey | KKUPIQIIROLAPT-GMDSZBONSA-N |
| XLogP | 0.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |