About 3-chloro-6-(2,6-difluorophenyl)-5-(2,3-dimethylbutan-2-yl)-1-ethylpyridin-2-one
3-chloro-6-(2,6-difluorophenyl)-5-(2,3-dimethylbutan-2-yl)-1-ethylpyridin-2-one (PubChem CID 146396991) has the molecular formula C19H22ClF2NO
and a molecular weight of 353.84 g/mol. Its IUPAC name is 3-chloro-6-(2,6-difluorophenyl)-5-(2,3-dimethylbutan-2-yl)-1-ethylpyridin-2-one.
Molecular Properties
| Compound Name | 3-chloro-6-(2,6-difluorophenyl)-5-(2,3-dimethylbutan-2-yl)-1-ethylpyridin-2-one |
| PubChem CID | 146396991 |
| Molecular Formula | C19H22ClF2NO |
| Molecular Weight | 353.84 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 3-chloro-6-(2,6-difluorophenyl)-5-(2,3-dimethylbutan-2-yl)-1-ethylpyridin-2-one |
| SMILES | CCn1c(-c2c(F)cccc2F)c(C(C)(C)C(C)C)cc(Cl)c1=O |
| InChI | InChI=1S/C19H22ClF2NO/c1-6-23-17(16-14(21)8-7-9-15(16)22)12(10-13(20)18(23)24)19(4,5)11(2)3/h7-11H,6H2,1-5H3 |
| InChIKey | NNPBEFWVTPBDJN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.84 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-6-(2,6-difluorophenyl)-5-(2,3-dimethylbutan-2-yl)-1-ethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-6-(2,6-difluorophenyl)-5-(2,3-dimethylbutan-2-yl)-1-ethylpyridin-2-one?
The IUPAC name of 3-chloro-6-(2,6-difluorophenyl)-5-(2,3-dimethylbutan-2-yl)-1-ethylpyridin-2-one (CID 146396991) is 3-chloro-6-(2,6-difluorophenyl)-5-(2,3-dimethylbutan-2-yl)-1-ethylpyridin-2-one.
What is the SMILES notation for 3-chloro-6-(2,6-difluorophenyl)-5-(2,3-dimethylbutan-2-yl)-1-ethylpyridin-2-one?
The canonical SMILES for 3-chloro-6-(2,6-difluorophenyl)-5-(2,3-dimethylbutan-2-yl)-1-ethylpyridin-2-one is CCn1c(-c2c(F)cccc2F)c(C(C)(C)C(C)C)cc(Cl)c1=O.
What is the InChIKey of 3-chloro-6-(2,6-difluorophenyl)-5-(2,3-dimethylbutan-2-yl)-1-ethylpyridin-2-one?
The InChIKey is NNPBEFWVTPBDJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22ClF2NO/c1-6-23-17(16-14(21)8-7-9-15(16)22)12(10-13(20)18(23)24)19(4,5)11(2)3/h7-11H,6H2,1-5H3.
What are the key properties of 3-chloro-6-(2,6-difluorophenyl)-5-(2,3-dimethylbutan-2-yl)-1-ethylpyridin-2-one?
3-chloro-6-(2,6-difluorophenyl)-5-(2,3-dimethylbutan-2-yl)-1-ethylpyridin-2-one has a molecular weight of 353.84 g/mol, XLogP of 5.40, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-6-(2,6-difluorophenyl)-5-(2,3-dimethylbutan-2-yl)-1-ethylpyridin-2-one is sourced from PubChem (CID 146396991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).