About 2-[1-cyclopropyl-1-(2,2,2-trifluoroethoxy)propyl]pyridine
2-[1-cyclopropyl-1-(2,2,2-trifluoroethoxy)propyl]pyridine (PubChem CID 146397110) has the molecular formula C13H16F3NO
and a molecular weight of 259.27 g/mol. Its IUPAC name is 2-[1-cyclopropyl-1-(2,2,2-trifluoroethoxy)propyl]pyridine.
Molecular Properties
| Compound Name | 2-[1-cyclopropyl-1-(2,2,2-trifluoroethoxy)propyl]pyridine |
| PubChem CID | 146397110 |
| Molecular Formula | C13H16F3NO |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-[1-cyclopropyl-1-(2,2,2-trifluoroethoxy)propyl]pyridine |
| SMILES | CCC(OCC(F)(F)F)(c1ccccn1)C1CC1 |
| InChI | InChI=1S/C13H16F3NO/c1-2-12(10-6-7-10,18-9-13(14,15)16)11-5-3-4-8-17-11/h3-5,8,10H,2,6-7,9H2,1H3 |
| InChIKey | MWURZFNAYAYOSP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[1-cyclopropyl-1-(2,2,2-trifluoroethoxy)propyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-cyclopropyl-1-(2,2,2-trifluoroethoxy)propyl]pyridine?
The IUPAC name of 2-[1-cyclopropyl-1-(2,2,2-trifluoroethoxy)propyl]pyridine (CID 146397110) is 2-[1-cyclopropyl-1-(2,2,2-trifluoroethoxy)propyl]pyridine.
What is the SMILES notation for 2-[1-cyclopropyl-1-(2,2,2-trifluoroethoxy)propyl]pyridine?
The canonical SMILES for 2-[1-cyclopropyl-1-(2,2,2-trifluoroethoxy)propyl]pyridine is CCC(OCC(F)(F)F)(c1ccccn1)C1CC1.
What is the InChIKey of 2-[1-cyclopropyl-1-(2,2,2-trifluoroethoxy)propyl]pyridine?
The InChIKey is MWURZFNAYAYOSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F3NO/c1-2-12(10-6-7-10,18-9-13(14,15)16)11-5-3-4-8-17-11/h3-5,8,10H,2,6-7,9H2,1H3.
What are the key properties of 2-[1-cyclopropyl-1-(2,2,2-trifluoroethoxy)propyl]pyridine?
2-[1-cyclopropyl-1-(2,2,2-trifluoroethoxy)propyl]pyridine has a molecular weight of 259.27 g/mol, XLogP of 3.68, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-cyclopropyl-1-(2,2,2-trifluoroethoxy)propyl]pyridine is sourced from PubChem (CID 146397110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).