About 8-[[4-bromo-2-(trifluoromethyl)phenyl]sulfonylmethyl]-1,4-dioxaspiro[4.5]decane
8-[[4-bromo-2-(trifluoromethyl)phenyl]sulfonylmethyl]-1,4-dioxaspiro[4.5]decane (PubChem CID 146397646) has the molecular formula C16H18BrF3O4S
and a molecular weight of 443.28 g/mol. Its IUPAC name is 8-[[4-bromo-2-(trifluoromethyl)phenyl]sulfonylmethyl]-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8-[[4-bromo-2-(trifluoromethyl)phenyl]sulfonylmethyl]-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 146397646 |
| Molecular Formula | C16H18BrF3O4S |
| Molecular Weight | 443.28 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | 8-[[4-bromo-2-(trifluoromethyl)phenyl]sulfonylmethyl]-1,4-dioxaspiro[4.5]decane |
| SMILES | O=S(=O)(CC1CCC2(CC1)OCCO2)c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C16H18BrF3O4S/c17-12-1-2-14(13(9-12)16(18,19)20)25(21,22)10-11-3-5-15(6-4-11)23-7-8-24-15/h1-2,9,11H,3-8,10H2 |
| InChIKey | LSQLYJXDWOZFBU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.28 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-[[4-bromo-2-(trifluoromethyl)phenyl]sulfonylmethyl]-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[[4-bromo-2-(trifluoromethyl)phenyl]sulfonylmethyl]-1,4-dioxaspiro[4.5]decane?
The IUPAC name of 8-[[4-bromo-2-(trifluoromethyl)phenyl]sulfonylmethyl]-1,4-dioxaspiro[4.5]decane (CID 146397646) is 8-[[4-bromo-2-(trifluoromethyl)phenyl]sulfonylmethyl]-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for 8-[[4-bromo-2-(trifluoromethyl)phenyl]sulfonylmethyl]-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for 8-[[4-bromo-2-(trifluoromethyl)phenyl]sulfonylmethyl]-1,4-dioxaspiro[4.5]decane is O=S(=O)(CC1CCC2(CC1)OCCO2)c1ccc(Br)cc1C(F)(F)F.
What is the InChIKey of 8-[[4-bromo-2-(trifluoromethyl)phenyl]sulfonylmethyl]-1,4-dioxaspiro[4.5]decane?
The InChIKey is LSQLYJXDWOZFBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18BrF3O4S/c17-12-1-2-14(13(9-12)16(18,19)20)25(21,22)10-11-3-5-15(6-4-11)23-7-8-24-15/h1-2,9,11H,3-8,10H2.
What are the key properties of 8-[[4-bromo-2-(trifluoromethyl)phenyl]sulfonylmethyl]-1,4-dioxaspiro[4.5]decane?
8-[[4-bromo-2-(trifluoromethyl)phenyl]sulfonylmethyl]-1,4-dioxaspiro[4.5]decane has a molecular weight of 443.28 g/mol, XLogP of 4.17, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[[4-bromo-2-(trifluoromethyl)phenyl]sulfonylmethyl]-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 146397646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).