About 6-bromo-3,5-difluoro-2,3-dihydropyridine
6-bromo-3,5-difluoro-2,3-dihydropyridine (PubChem CID 146397651) has the molecular formula C5H4BrF2N
and a molecular weight of 195.99 g/mol. Its IUPAC name is 6-bromo-3,5-difluoro-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 6-bromo-3,5-difluoro-2,3-dihydropyridine |
| PubChem CID | 146397651 |
| Molecular Formula | C5H4BrF2N |
| Molecular Weight | 195.99 g/mol |
| Exact Mass | 194.95 |
| IUPAC Name | 6-bromo-3,5-difluoro-2,3-dihydropyridine |
| SMILES | FC1=CC(F)CN=C1Br |
| InChI | InChI=1S/C5H4BrF2N/c6-5-4(8)1-3(7)2-9-5/h1,3H,2H2 |
| InChIKey | ROEKWALAJCUSKX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.99 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-3,5-difluoro-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3,5-difluoro-2,3-dihydropyridine?
The IUPAC name of 6-bromo-3,5-difluoro-2,3-dihydropyridine (CID 146397651) is 6-bromo-3,5-difluoro-2,3-dihydropyridine.
What is the SMILES notation for 6-bromo-3,5-difluoro-2,3-dihydropyridine?
The canonical SMILES for 6-bromo-3,5-difluoro-2,3-dihydropyridine is FC1=CC(F)CN=C1Br.
What is the InChIKey of 6-bromo-3,5-difluoro-2,3-dihydropyridine?
The InChIKey is ROEKWALAJCUSKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4BrF2N/c6-5-4(8)1-3(7)2-9-5/h1,3H,2H2.
What are the key properties of 6-bromo-3,5-difluoro-2,3-dihydropyridine?
6-bromo-3,5-difluoro-2,3-dihydropyridine has a molecular weight of 195.99 g/mol, XLogP of 1.98, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3,5-difluoro-2,3-dihydropyridine is sourced from PubChem (CID 146397651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).